churchillvanessam churchillvanessam

03-10-2020
Chemistry

contestada

For NH4NO3(s) write a balanced thermochemical equation.

Respuesta :

sagarsaud666 sagarsaud666

03-10-2020

Answer:

step1

NH4NO3(s)+H2O(I)--------->NH⁴OH(aq)+HNO³(aq)

step²

NH⁴OH(aq)+HNO³(aq)-------->NH⁴+(aq)+NO³-(aq)+H²O(I)

Answer Link

Otras preguntas

What are the four most common gases in dry air?

SOMEONE PLEASE HELP ME ;( Your teacher asked your class to describe a real-world situation in which a y-intercept is 100 and the slope is 5. Your partner gave

Write the converse of the following statement: "If oranges are sold at four for 99cents, then each orange costs less then 25cents"

where did sir Thomas more work?

describe what happens when a cells divide uncontrollably

Which of these attributes is generally attributed to Kepler A).The Orbit of Mars is an Ellipse B).The Earth is Round C).Force of Gravity Between 2 objects Decre

Which describes the role of sunlight in chemical reactions?

The sales tax on a new camera is $5.60, which is 8% of the total price.What is the price of the camera?

Rollie was succesful in losing weight he had a goal weight in mind he went on a diet for three months each month he would lose one third of the difference betw

solve 58x29 using an area model